C27H35FN2O2 — CID 100663159
1-(2-fluorophenyl)-N-[4-[3-(4-methylpiperidin-1-yl)propoxy]phenyl]cyclopentane-1-carboxamide (PubChem CID 100663159) has the molecular formula C27H35FN2O2 and a molecular weight of 438.59 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[4-[3-(4-methylpiperidin-1-yl)propoxy]phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[4-[3-(4-methylpiperidin-1-yl)propoxy]phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100663159 |
| Molecular Formula | C27H35FN2O2 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[4-[3-(4-methylpiperidin-1-yl)propoxy]phenyl]cyclopentane-1-carboxamide |
| SMILES | CC1CCN(CCCOc2ccc(NC(=O)C3(c4ccccc4F)CCCC3)cc2)CC1 |
| InChI | InChI=1S/C27H35FN2O2/c1-21-13-18-30(19-14-21)17-6-20-32-23-11-9-22(10-12-23)29-26(31)27(15-4-5-16-27)24-7-2-3-8-25(24)28/h2-3,7-12,21H,4-6,13-20H2,1H3,(H,29,31) |
| InChIKey | LRAHBFKHZGRDBQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|