C27H35ClN2O2 — CID 100666816
1-(2-chlorophenyl)-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide (PubChem CID 100666816) has the molecular formula C27H35ClN2O2 and a molecular weight of 455.04 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100666816 |
| Molecular Formula | C27H35ClN2O2 |
| Molecular Weight | 455.04 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[4-[3-[(2R)-2-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide |
| SMILES | C[C@@H]1CCCCN1CCCOc1ccc(NC(=O)C2(c3ccccc3Cl)CCCC2)cc1 |
| InChI | InChI=1S/C27H35ClN2O2/c1-21-9-4-7-18-30(21)19-8-20-32-23-14-12-22(13-15-23)29-26(31)27(16-5-6-17-27)24-10-2-3-11-25(24)28/h2-3,10-15,21H,4-9,16-20H2,1H3,(H,29,31)/t21-/m1/s1 |
| InChIKey | GBOBIXZFTZCLCI-OAQYLSRUSA-N |
| XLogP | 6.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.04 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|