C27H36N2O3 — CID 100679341
N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-4-phenyloxane-4-carboxamide (PubChem CID 100679341) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 100679341 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-[4-[3-[(2S)-2-methylpiperidin-1-yl]propoxy]phenyl]-4-phenyloxane-4-carboxamide |
| SMILES | C[C@H]1CCCCN1CCCOc1ccc(NC(=O)C2(c3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C27H36N2O3/c1-22-8-5-6-17-29(22)18-7-19-32-25-13-11-24(12-14-25)28-26(30)27(15-20-31-21-16-27)23-9-3-2-4-10-23/h2-4,9-14,22H,5-8,15-21H2,1H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | DPHHZVIOMWBTIG-QFIPXVFZSA-N |
| XLogP | 5.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|