C26H34N2O3 — CID 100679278
4-phenyl-N-[4-(3-piperidin-1-ylpropoxy)phenyl]oxane-4-carboxamide (PubChem CID 100679278) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-phenyl-N-[4-(3-piperidin-1-ylpropoxy)phenyl]oxane-4-carboxamide.
| Compound Name | 4-phenyl-N-[4-(3-piperidin-1-ylpropoxy)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 100679278 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 4-phenyl-N-[4-(3-piperidin-1-ylpropoxy)phenyl]oxane-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCCCN2CCCCC2)cc1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C26H34N2O3/c29-25(26(14-20-30-21-15-26)22-8-3-1-4-9-22)27-23-10-12-24(13-11-23)31-19-7-18-28-16-5-2-6-17-28/h1,3-4,8-13H,2,5-7,14-21H2,(H,27,29) |
| InChIKey | HREHBWLXWCTHED-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|