C25H30Cl2N2O3 — CID 100686497
4-(2,4-dichlorophenyl)-N-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide (PubChem CID 100686497) has the molecular formula C25H30Cl2N2O3 and a molecular weight of 477.43 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 100686497 |
| Molecular Formula | C25H30Cl2N2O3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]oxane-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCCCN2CCCC2)cc1)C1(c2ccc(Cl)cc2Cl)CCOCC1 |
| InChI | InChI=1S/C25H30Cl2N2O3/c26-19-4-9-22(23(27)18-19)25(10-16-31-17-11-25)24(30)28-20-5-7-21(8-6-20)32-15-3-14-29-12-1-2-13-29/h4-9,18H,1-3,10-17H2,(H,28,30) |
| InChIKey | JDGGGRHPTRXAKT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|