C28H36Cl2N2O2 — CID 133194312
1-(2,4-dichlorophenyl)-N-[4-[3-(2-methylpiperidin-1-yl)propoxy]phenyl]cyclohexane-1-carboxamide (PubChem CID 133194312) has the molecular formula C28H36Cl2N2O2 and a molecular weight of 503.51 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[4-[3-(2-methylpiperidin-1-yl)propoxy]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[4-[3-(2-methylpiperidin-1-yl)propoxy]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 133194312 |
| Molecular Formula | C28H36Cl2N2O2 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[4-[3-(2-methylpiperidin-1-yl)propoxy]phenyl]cyclohexane-1-carboxamide |
| SMILES | CC1CCCCN1CCCOc1ccc(NC(=O)C2(c3ccc(Cl)cc3Cl)CCCCC2)cc1 |
| InChI | InChI=1S/C28H36Cl2N2O2/c1-21-8-3-6-17-32(21)18-7-19-34-24-12-10-23(11-13-24)31-27(33)28(15-4-2-5-16-28)25-14-9-22(29)20-26(25)30/h9-14,20-21H,2-8,15-19H2,1H3,(H,31,33) |
| InChIKey | HUPOJHOCJHWBDB-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|