C20H22BrNO3 — CID 100679083
N-[4-(2-bromoethoxy)phenyl]-4-phenyloxane-4-carboxamide (PubChem CID 100679083) has the molecular formula C20H22BrNO3 and a molecular weight of 404.30 g/mol. Its IUPAC name is N-[4-(2-bromoethoxy)phenyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[4-(2-bromoethoxy)phenyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 100679083 |
| Molecular Formula | C20H22BrNO3 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[4-(2-bromoethoxy)phenyl]-4-phenyloxane-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCCBr)cc1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C20H22BrNO3/c21-12-15-25-18-8-6-17(7-9-18)22-19(23)20(10-13-24-14-11-20)16-4-2-1-3-5-16/h1-9H,10-15H2,(H,22,23) |
| InChIKey | ZWIZSGYBRZBMQW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|