C26H27NO3 — CID 100681565
4-(4-methylphenyl)-N-(4-phenylmethoxyphenyl)oxane-4-carboxamide (PubChem CID 100681565) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-(4-phenylmethoxyphenyl)oxane-4-carboxamide.
| Compound Name | 4-(4-methylphenyl)-N-(4-phenylmethoxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 100681565 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-(4-methylphenyl)-N-(4-phenylmethoxyphenyl)oxane-4-carboxamide |
| SMILES | Cc1ccc(C2(C(=O)Nc3ccc(OCc4ccccc4)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C26H27NO3/c1-20-7-9-22(10-8-20)26(15-17-29-18-16-26)25(28)27-23-11-13-24(14-12-23)30-19-21-5-3-2-4-6-21/h2-14H,15-19H2,1H3,(H,27,28) |
| InChIKey | JQRHDAXLROJOQH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |