C24H24N2O3 — CID 55787731
N-[6-(4-methylphenoxy)-3-pyridinyl]-4-phenyloxane-4-carboxamide (PubChem CID 55787731) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[6-(4-methylphenoxy)-3-pyridinyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[6-(4-methylphenoxy)-3-pyridinyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 55787731 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[6-(4-methylphenoxy)-3-pyridinyl]-4-phenyloxane-4-carboxamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)C3(c4ccccc4)CCOCC3)cn2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-18-7-10-21(11-8-18)29-22-12-9-20(17-25-22)26-23(27)24(13-15-28-16-14-24)19-5-3-2-4-6-19/h2-12,17H,13-16H2,1H3,(H,26,27) |
| InChIKey | MQHPOCFBJOILTK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |