C19H23N3O3 — CID 120798308
2-amino-N-[6-(4-methylphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide (PubChem CID 120798308) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-amino-N-[6-(4-methylphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[6-(4-methylphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120798308 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-amino-N-[6-(4-methylphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)C(N)C3CCOCC3)cn2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13-2-5-16(6-3-13)25-17-7-4-15(12-21-17)22-19(23)18(20)14-8-10-24-11-9-14/h2-7,12,14,18H,8-11,20H2,1H3,(H,22,23) |
| InChIKey | ULNDSBSHMYCAIT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |