C21H26N2O4 — CID 120783556
2-amino-N-[4-(4-ethoxyphenoxy)phenyl]-2-(oxan-4-yl)acetamide (PubChem CID 120783556) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-amino-N-[4-(4-ethoxyphenoxy)phenyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[4-(4-ethoxyphenoxy)phenyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120783556 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-amino-N-[4-(4-ethoxyphenoxy)phenyl]-2-(oxan-4-yl)acetamide |
| SMILES | CCOc1ccc(Oc2ccc(NC(=O)C(N)C3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-2-26-17-7-9-19(10-8-17)27-18-5-3-16(4-6-18)23-21(24)20(22)15-11-13-25-14-12-15/h3-10,15,20H,2,11-14,22H2,1H3,(H,23,24) |
| InChIKey | LDGOCPQMGAYUON-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |