C19H25Cl2N3O4 — CID 120801081
2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide;dihydrochloride (PubChem CID 120801081) has the molecular formula C19H25Cl2N3O4 and a molecular weight of 430.33 g/mol. Its IUPAC name is 2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120801081 |
| Molecular Formula | C19H25Cl2N3O4 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-amino-N-[6-(4-methoxyphenoxy)-3-pyridinyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
| SMILES | COc1ccc(Oc2ccc(NC(=O)C(N)C3CCOCC3)cn2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H23N3O4.2ClH/c1-24-15-3-5-16(6-4-15)26-17-7-2-14(12-21-17)22-19(23)18(20)13-8-10-25-11-9-13;;/h2-7,12-13,18H,8-11,20H2,1H3,(H,22,23);2*1H |
| InChIKey | OPFGARCVXQRKOZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |