C16H25ClN2O3 — CID 120782919
2-amino-N-[2-(4-methoxyphenyl)ethyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120782919) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-amino-N-[2-(4-methoxyphenyl)ethyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(4-methoxyphenyl)ethyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120782919 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-amino-N-[2-(4-methoxyphenyl)ethyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | COc1ccc(CCNC(=O)C(N)C2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C16H24N2O3.ClH/c1-20-14-4-2-12(3-5-14)6-9-18-16(19)15(17)13-7-10-21-11-8-13;/h2-5,13,15H,6-11,17H2,1H3,(H,18,19);1H |
| InChIKey | URZLTNDSNLGONC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |