C18H28N2O4 — CID 120790284
2-amino-N-[3-(3,4-dimethoxyphenyl)propyl]-2-(oxan-4-yl)acetamide (PubChem CID 120790284) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-amino-N-[3-(3,4-dimethoxyphenyl)propyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[3-(3,4-dimethoxyphenyl)propyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120790284 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-amino-N-[3-(3,4-dimethoxyphenyl)propyl]-2-(oxan-4-yl)acetamide |
| SMILES | COc1ccc(CCCNC(=O)C(N)C2CCOCC2)cc1OC |
| InChI | InChI=1S/C18H28N2O4/c1-22-15-6-5-13(12-16(15)23-2)4-3-9-20-18(21)17(19)14-7-10-24-11-8-14/h5-6,12,14,17H,3-4,7-11,19H2,1-2H3,(H,20,21) |
| InChIKey | MBSRGGZXEDWWLU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|