C16H24N2O4 — CID 66750690
(2S)-2-amino-3-(3,4-dimethoxyphenyl)-N-(oxan-4-yl)propanamide (PubChem CID 66750690) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dimethoxyphenyl)-N-(oxan-4-yl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dimethoxyphenyl)-N-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 66750690 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dimethoxyphenyl)-N-(oxan-4-yl)propanamide |
| SMILES | COc1ccc(C[C@H](N)C(=O)NC2CCOCC2)cc1OC |
| InChI | InChI=1S/C16H24N2O4/c1-20-14-4-3-11(10-15(14)21-2)9-13(17)16(19)18-12-5-7-22-8-6-12/h3-4,10,12-13H,5-9,17H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | LRAZPWWYYGBLEZ-ZDUSSCGKSA-N |
| XLogP | 0.87 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |