C13H17NO5 — CID 117421344
2-amino-3-[3-methoxy-4-(oxetan-3-yloxy)phenyl]propanoic acid (PubChem CID 117421344) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-amino-3-[3-methoxy-4-(oxetan-3-yloxy)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-methoxy-4-(oxetan-3-yloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117421344 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-amino-3-[3-methoxy-4-(oxetan-3-yloxy)phenyl]propanoic acid |
| SMILES | COc1cc(CC(N)C(=O)O)ccc1OC1COC1 |
| InChI | InChI=1S/C13H17NO5/c1-17-12-5-8(4-10(14)13(15)16)2-3-11(12)19-9-6-18-7-9/h2-3,5,9-10H,4,6-7,14H2,1H3,(H,15,16) |
| InChIKey | JCDNWVLTCRTEDZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |