C12H14O5 — CID 115004769
2-[4-methoxy-3-(oxetan-3-yloxy)phenyl]acetic acid (PubChem CID 115004769) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-[4-methoxy-3-(oxetan-3-yloxy)phenyl]acetic acid.
| Compound Name | 2-[4-methoxy-3-(oxetan-3-yloxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 115004769 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-[4-methoxy-3-(oxetan-3-yloxy)phenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1OC1COC1 |
| InChI | InChI=1S/C12H14O5/c1-15-10-3-2-8(5-12(13)14)4-11(10)17-9-6-16-7-9/h2-4,9H,5-7H2,1H3,(H,13,14) |
| InChIKey | HAGDINBOPNGZEE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |