C14H18O5 — CID 62805451
2-(3,4-dimethoxyphenyl)-1-(1,4-dioxan-2-yl)ethanone (PubChem CID 62805451) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-(1,4-dioxan-2-yl)ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-(1,4-dioxan-2-yl)ethanone |
|---|---|
| PubChem CID | 62805451 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-(1,4-dioxan-2-yl)ethanone |
| SMILES | COc1ccc(CC(=O)C2COCCO2)cc1OC |
| InChI | InChI=1S/C14H18O5/c1-16-12-4-3-10(8-13(12)17-2)7-11(15)14-9-18-5-6-19-14/h3-4,8,14H,5-7,9H2,1-2H3 |
| InChIKey | CSUUGIBBDQUPRF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |