C13H15FO3S — CID 79965827
2-(3-fluoro-4-methoxyphenyl)-1-(1,4-oxathian-2-yl)ethanone (PubChem CID 79965827) has the molecular formula C13H15FO3S and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1-(1,4-oxathian-2-yl)ethanone.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1-(1,4-oxathian-2-yl)ethanone |
|---|---|
| PubChem CID | 79965827 |
| Molecular Formula | C13H15FO3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1-(1,4-oxathian-2-yl)ethanone |
| SMILES | COc1ccc(CC(=O)C2CSCCO2)cc1F |
| InChI | InChI=1S/C13H15FO3S/c1-16-12-3-2-9(6-10(12)14)7-11(15)13-8-18-5-4-17-13/h2-3,6,13H,4-5,7-8H2,1H3 |
| InChIKey | UIWMKPJUFYRCGI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |