C16H19FO2S — CID 171940849
2-(3-fluoro-4-methoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone (PubChem CID 171940849) has the molecular formula C16H19FO2S and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone |
|---|---|
| PubChem CID | 171940849 |
| Molecular Formula | C16H19FO2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone |
| SMILES | COc1ccc(CC(=O)C2CC3CCC(C2)S3)cc1F |
| InChI | InChI=1S/C16H19FO2S/c1-19-16-5-2-10(6-14(16)17)7-15(18)11-8-12-3-4-13(9-11)20-12/h2,5-6,11-13H,3-4,7-9H2,1H3 |
| InChIKey | MHIYKTHFBSVERR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |