C22H30FNO4 — CID 171940855
tert-butyl 3-[2-(3-fluoro-4-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171940855) has the molecular formula C22H30FNO4 and a molecular weight of 391.48 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-fluoro-4-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-[2-(3-fluoro-4-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171940855 |
| Molecular Formula | C22H30FNO4 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | tert-butyl 3-[2-(3-fluoro-4-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | COc1ccc(CC(=O)C2CC3CCCC(C2)N3C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C22H30FNO4/c1-22(2,3)28-21(26)24-16-6-5-7-17(24)13-15(12-16)19(25)11-14-8-9-20(27-4)18(23)10-14/h8-10,15-17H,5-7,11-13H2,1-4H3 |
| InChIKey | KZZRPKMLBWLOOY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |