C25H37NO3 — CID 171949722
tert-butyl 3-[2-(4-tert-butylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171949722) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-tert-butylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-tert-butylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171949722 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | tert-butyl 3-[2-(4-tert-butylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1CC(C(=O)Cc1ccc(C(C)(C)C)cc1)C2 |
| InChI | InChI=1S/C25H37NO3/c1-24(2,3)19-12-10-17(11-13-19)14-22(27)18-15-20-8-7-9-21(16-18)26(20)23(28)29-25(4,5)6/h10-13,18,20-21H,7-9,14-16H2,1-6H3 |
| InChIKey | MRLUVILOZDUOCN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |