C11H19NO2 — CID 169176648
tert-butyl (5R)-6-azabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 169176648) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is tert-butyl (5R)-6-azabicyclo[3.1.1]heptane-6-carboxylate.
| Compound Name | tert-butyl (5R)-6-azabicyclo[3.1.1]heptane-6-carboxylate |
|---|---|
| PubChem CID | 169176648 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | tert-butyl (5R)-6-azabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC[C@@H]1C2 |
| InChI | InChI=1S/C11H19NO2/c1-11(2,3)14-10(13)12-8-5-4-6-9(12)7-8/h8-9H,4-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | TVCGBLPRTDRMKX-VEDVMXKPSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |