C13H25N3O2 — CID 171951229
tert-butyl 3-hydrazinyl-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171951229) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is tert-butyl 3-hydrazinyl-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-hydrazinyl-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171951229 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | tert-butyl 3-hydrazinyl-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1CC(NN)C2 |
| InChI | InChI=1S/C13H25N3O2/c1-13(2,3)18-12(17)16-10-5-4-6-11(16)8-9(7-10)15-14/h9-11,15H,4-8,14H2,1-3H3 |
| InChIKey | MDDBHHHLRFTMSI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|