C12H21NO2 — CID 69350476
tert-butyl 8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 69350476) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is tert-butyl 8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 69350476 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | tert-butyl 8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1CC2 |
| InChI | InChI=1S/C12H21NO2/c1-12(2,3)15-11(14)13-9-5-4-6-10(13)8-7-9/h9-10H,4-8H2,1-3H3 |
| InChIKey | GDYVHALUVFLVMF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |