C21H26F3NO3 — CID 171941448
tert-butyl 3-[2-(2,3,6-trifluorophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171941448) has the molecular formula C21H26F3NO3 and a molecular weight of 397.44 g/mol. Its IUPAC name is tert-butyl 3-[2-(2,3,6-trifluorophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-[2-(2,3,6-trifluorophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171941448 |
| Molecular Formula | C21H26F3NO3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | tert-butyl 3-[2-(2,3,6-trifluorophenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1CC(C(=O)Cc1c(F)ccc(F)c1F)C2 |
| InChI | InChI=1S/C21H26F3NO3/c1-21(2,3)28-20(27)25-13-5-4-6-14(25)10-12(9-13)18(26)11-15-16(22)7-8-17(23)19(15)24/h7-8,12-14H,4-6,9-11H2,1-3H3 |
| InChIKey | IWUZKNMUNBVSQN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|