C21H28FNO3 — CID 171948212
tert-butyl 3-[3-(2-fluorophenyl)propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171948212) has the molecular formula C21H28FNO3 and a molecular weight of 361.46 g/mol. Its IUPAC name is tert-butyl 3-[3-(2-fluorophenyl)propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[3-(2-fluorophenyl)propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171948212 |
| Molecular Formula | C21H28FNO3 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | tert-butyl 3-[3-(2-fluorophenyl)propanoyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(C(=O)CCc1ccccc1F)C2 |
| InChI | InChI=1S/C21H28FNO3/c1-21(2,3)26-20(25)23-16-9-10-17(23)13-15(12-16)19(24)11-8-14-6-4-5-7-18(14)22/h4-7,15-17H,8-13H2,1-3H3 |
| InChIKey | UWHQBVPEOWCSCT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |