C10H11FO3 — CID 82282114
1-(3-fluoro-4-methoxyphenyl)-3-hydroxypropan-2-one (PubChem CID 82282114) has the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-3-hydroxypropan-2-one.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-3-hydroxypropan-2-one |
|---|---|
| PubChem CID | 82282114 |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-3-hydroxypropan-2-one |
| SMILES | COc1ccc(CC(=O)CO)cc1F |
| InChI | InChI=1S/C10H11FO3/c1-14-10-3-2-7(5-9(10)11)4-8(13)6-12/h2-3,5,12H,4,6H2,1H3 |
| InChIKey | WQWCYOYIUYWRQW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |