C16H13Cl2FO2 — CID 62622130
1-(3,4-dichlorophenyl)-3-(3-fluoro-4-methoxyphenyl)propan-2-one (PubChem CID 62622130) has the molecular formula C16H13Cl2FO2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(3-fluoro-4-methoxyphenyl)propan-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(3-fluoro-4-methoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 62622130 |
| Molecular Formula | C16H13Cl2FO2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(3-fluoro-4-methoxyphenyl)propan-2-one |
| SMILES | COc1ccc(CC(=O)Cc2ccc(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C16H13Cl2FO2/c1-21-16-5-3-11(9-15(16)19)7-12(20)6-10-2-4-13(17)14(18)8-10/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | NQMSXQDFQHAKRP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |