C16H15ClFNO2 — CID 9042461
N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyphenyl)acetamide (PubChem CID 9042461) has the molecular formula C16H15ClFNO2 and a molecular weight of 307.75 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyphenyl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9042461 |
| Molecular Formula | C16H15ClFNO2 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCc2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C16H15ClFNO2/c1-21-15-7-4-12(8-14(15)18)9-16(20)19-10-11-2-5-13(17)6-3-11/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | RCRKNNJCJAANNA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |