C16H16ClFN2O2 — CID 47064115
N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyanilino)acetamide (PubChem CID 47064115) has the molecular formula C16H16ClFN2O2 and a molecular weight of 322.77 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyanilino)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 47064115 |
| Molecular Formula | C16H16ClFN2O2 |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(3-fluoro-4-methoxyanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)NCc2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C16H16ClFN2O2/c1-22-15-7-6-13(8-14(15)18)19-10-16(21)20-9-11-2-4-12(17)5-3-11/h2-8,19H,9-10H2,1H3,(H,20,21) |
| InChIKey | KEFQCGCFHGGRFK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|