C24H24FN3O3 — CID 55897755
2-[[2-(3-fluoro-4-methoxyanilino)acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 55897755) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-[[2-(3-fluoro-4-methoxyanilino)acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 2-[[2-(3-fluoro-4-methoxyanilino)acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55897755 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[[2-(3-fluoro-4-methoxyanilino)acetyl]amino]-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | COc1ccc(NCC(=O)Nc2ccccc2C(=O)NCc2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C24H24FN3O3/c1-16-7-9-17(10-8-16)14-27-24(30)19-5-3-4-6-21(19)28-23(29)15-26-18-11-12-22(31-2)20(25)13-18/h3-13,26H,14-15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | FOAKFWUYAUWFMI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|