C28H30N2O5 — CID 55759450
2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 55759450) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55759450 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2-[4-(4-acetyl-2-methoxyphenoxy)butanoylamino]-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)Nc1ccccc1C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C28H30N2O5/c1-19-10-12-21(13-11-19)18-29-28(33)23-7-4-5-8-24(23)30-27(32)9-6-16-35-25-15-14-22(20(2)31)17-26(25)34-3/h4-5,7-8,10-15,17H,6,9,16,18H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | QTQBOVIIIHZPDR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|