C20H22BrNO4 — CID 55738606
4-(4-acetyl-2-methoxyphenoxy)-N-(3-bromo-4-methylphenyl)butanamide (PubChem CID 55738606) has the molecular formula C20H22BrNO4 and a molecular weight of 420.30 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-(3-bromo-4-methylphenyl)butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-(3-bromo-4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 55738606 |
| Molecular Formula | C20H22BrNO4 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-(3-bromo-4-methylphenyl)butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)Nc1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C20H22BrNO4/c1-13-6-8-16(12-17(13)21)22-20(24)5-4-10-26-18-9-7-15(14(2)23)11-19(18)25-3/h6-9,11-12H,4-5,10H2,1-3H3,(H,22,24) |
| InChIKey | LDQUQCXYEJETJI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|