C19H22BrNO4 — CID 19201751
4-(2-bromo-4-methylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide (PubChem CID 19201751) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide.
| Compound Name | 4-(2-bromo-4-methylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 19201751 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-(2-bromo-4-methylphenoxy)-N-(3,4-dimethoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCOc2ccc(C)cc2Br)cc1OC |
| InChI | InChI=1S/C19H22BrNO4/c1-13-6-8-16(15(20)11-13)25-10-4-5-19(22)21-14-7-9-17(23-2)18(12-14)24-3/h6-9,11-12H,4-5,10H2,1-3H3,(H,21,22) |
| InChIKey | CZWNSWGDAHMNRG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|