C18H19BrN2O4 — CID 19202501
4-(2-bromo-4-methylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide (PubChem CID 19202501) has the molecular formula C18H19BrN2O4 and a molecular weight of 407.26 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide.
| Compound Name | 4-(2-bromo-4-methylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 19202501 |
| Molecular Formula | C18H19BrN2O4 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 4-(2-bromo-4-methylphenoxy)-N-(4-methyl-3-nitrophenyl)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)Nc2ccc(C)c([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C18H19BrN2O4/c1-12-5-8-17(15(19)10-12)25-9-3-4-18(22)20-14-7-6-13(2)16(11-14)21(23)24/h5-8,10-11H,3-4,9H2,1-2H3,(H,20,22) |
| InChIKey | GXTDWGOVJCYAAH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|