C17H17BrINO2 — CID 19202098
4-(2-bromo-4-methylphenoxy)-N-(4-iodophenyl)butanamide (PubChem CID 19202098) has the molecular formula C17H17BrINO2 and a molecular weight of 474.14 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenoxy)-N-(4-iodophenyl)butanamide.
| Compound Name | 4-(2-bromo-4-methylphenoxy)-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 19202098 |
| Molecular Formula | C17H17BrINO2 |
| Molecular Weight | 474.14 g/mol |
| Exact Mass | 472.95 |
| IUPAC Name | 4-(2-bromo-4-methylphenoxy)-N-(4-iodophenyl)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)Nc2ccc(I)cc2)c(Br)c1 |
| InChI | InChI=1S/C17H17BrINO2/c1-12-4-9-16(15(18)11-12)22-10-2-3-17(21)20-14-7-5-13(19)6-8-14/h4-9,11H,2-3,10H2,1H3,(H,20,21) |
| InChIKey | UYGKFEIYXAIVKS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.14 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|