C18H19ClINO2 — CID 19191112
4-(4-chloro-3,5-dimethylphenoxy)-N-(4-iodophenyl)butanamide (PubChem CID 19191112) has the molecular formula C18H19ClINO2 and a molecular weight of 443.71 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)-N-(4-iodophenyl)butanamide.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-(4-iodophenyl)butanamide |
|---|---|
| PubChem CID | 19191112 |
| Molecular Formula | C18H19ClINO2 |
| Molecular Weight | 443.71 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)-N-(4-iodophenyl)butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2ccc(I)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C18H19ClINO2/c1-12-10-16(11-13(2)18(12)19)23-9-3-4-17(22)21-15-7-5-14(20)6-8-15/h5-8,10-11H,3-4,9H2,1-2H3,(H,21,22) |
| InChIKey | MDIHGYFANNRKGH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|