C15H20ClNO4 — CID 53263869
2-[4-(4-chloro-3,5-dimethylphenoxy)butanoylamino]propanoic acid (PubChem CID 53263869) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-[4-(4-chloro-3,5-dimethylphenoxy)butanoylamino]propanoic acid.
| Compound Name | 2-[4-(4-chloro-3,5-dimethylphenoxy)butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 53263869 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[4-(4-chloro-3,5-dimethylphenoxy)butanoylamino]propanoic acid |
| SMILES | Cc1cc(OCCCC(=O)NC(C)C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C15H20ClNO4/c1-9-7-12(8-10(2)14(9)16)21-6-4-5-13(18)17-11(3)15(19)20/h7-8,11H,4-6H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | CQSHNNZEIPBBKN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|