C18H19ClO3 — CID 19206113
phenyl 4-(4-chloro-3,5-dimethylphenoxy)butanoate (PubChem CID 19206113) has the molecular formula C18H19ClO3 and a molecular weight of 318.80 g/mol. Its IUPAC name is phenyl 4-(4-chloro-3,5-dimethylphenoxy)butanoate.
| Compound Name | phenyl 4-(4-chloro-3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19206113 |
| Molecular Formula | C18H19ClO3 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | phenyl 4-(4-chloro-3,5-dimethylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)Oc2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C18H19ClO3/c1-13-11-16(12-14(2)18(13)19)21-10-6-9-17(20)22-15-7-4-3-5-8-15/h3-5,7-8,11-12H,6,9-10H2,1-2H3 |
| InChIKey | QKUIHVSTBYGBRE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|