C26H26ClNO4 — CID 19206146
[4-[(4-methylphenyl)carbamoyl]phenyl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate (PubChem CID 19206146) has the molecular formula C26H26ClNO4 and a molecular weight of 451.95 g/mol. Its IUPAC name is [4-[(4-methylphenyl)carbamoyl]phenyl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate.
| Compound Name | [4-[(4-methylphenyl)carbamoyl]phenyl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19206146 |
| Molecular Formula | C26H26ClNO4 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [4-[(4-methylphenyl)carbamoyl]phenyl] 4-(4-chloro-3,5-dimethylphenoxy)butanoate |
| SMILES | Cc1ccc(NC(=O)c2ccc(OC(=O)CCCOc3cc(C)c(Cl)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C26H26ClNO4/c1-17-6-10-21(11-7-17)28-26(30)20-8-12-22(13-9-20)32-24(29)5-4-14-31-23-15-18(2)25(27)19(3)16-23/h6-13,15-16H,4-5,14H2,1-3H3,(H,28,30) |
| InChIKey | OWGHOWMHXYUGLO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|