C30H35NO4 — CID 2072193
[4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate (PubChem CID 2072193) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate.
| Compound Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 2072193 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [4-[(2,5-dimethylphenyl)carbamoyl]phenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Oc2ccc(C(=O)Nc3cc(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C30H35NO4/c1-6-30(4,5)24-13-17-25(18-14-24)34-19-7-8-28(32)35-26-15-11-23(12-16-26)29(33)31-27-20-21(2)9-10-22(27)3/h9-18,20H,6-8,19H2,1-5H3,(H,31,33) |
| InChIKey | LJYASNZHLKTVIQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|