C23H30O3 — CID 2072155
(3,4-dimethylphenyl) 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate (PubChem CID 2072155) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate.
| Compound Name | (3,4-dimethylphenyl) 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 2072155 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (3,4-dimethylphenyl) 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Oc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C23H30O3/c1-6-23(4,5)19-10-13-20(14-11-19)25-15-7-8-22(24)26-21-12-9-17(2)18(3)16-21/h9-14,16H,6-8,15H2,1-5H3 |
| InChIKey | VWXBFFULDZEIHN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|