C29H36N2O5 — CID 19237117
[4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate (PubChem CID 19237117) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate.
| Compound Name | [4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 19237117 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | [4-[(E)-2-cyano-3-oxo-3-(propylamino)prop-1-enyl]-2-methoxyphenyl] 4-[4-(2-methylbutan-2-yl)phenoxy]butanoate |
| SMILES | CCCNC(=O)/C(C#N)=C/c1ccc(OC(=O)CCCOc2ccc(C(C)(C)CC)cc2)c(OC)c1 |
| InChI | InChI=1S/C29H36N2O5/c1-6-16-31-28(33)22(20-30)18-21-10-15-25(26(19-21)34-5)36-27(32)9-8-17-35-24-13-11-23(12-14-24)29(3,4)7-2/h10-15,18-19H,6-9,16-17H2,1-5H3,(H,31,33)/b22-18+ |
| InChIKey | BKIGATPRCKSWCC-RELWKKBWSA-N |
| XLogP | 5.58 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|