C27H31BrN2O5 — CID 19219679
[4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2-bromo-4-ethylphenoxy)butanoate (PubChem CID 19219679) has the molecular formula C27H31BrN2O5 and a molecular weight of 543.46 g/mol. Its IUPAC name is [4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2-bromo-4-ethylphenoxy)butanoate.
| Compound Name | [4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2-bromo-4-ethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19219679 |
| Molecular Formula | C27H31BrN2O5 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | [4-[(E)-3-(butylamino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-(2-bromo-4-ethylphenoxy)butanoate |
| SMILES | CCCCNC(=O)/C(C#N)=C/c1ccc(OC(=O)CCCOc2ccc(CC)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C27H31BrN2O5/c1-4-6-13-30-27(32)21(18-29)15-20-10-12-24(25(17-20)33-3)35-26(31)8-7-14-34-23-11-9-19(5-2)16-22(23)28/h9-12,15-17H,4-8,13-14H2,1-3H3,(H,30,32)/b21-15+ |
| InChIKey | XIWFWEFWSRUXOI-RCCKNPSSSA-N |
| XLogP | 5.61 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|