C26H28BrNO6 — CID 19206404
ethyl (E)-3-[4-[4-(2-bromo-4-propan-2-ylphenoxy)butanoyloxy]-3-methoxyphenyl]-2-cyanoprop-2-enoate (PubChem CID 19206404) has the molecular formula C26H28BrNO6 and a molecular weight of 530.42 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-(2-bromo-4-propan-2-ylphenoxy)butanoyloxy]-3-methoxyphenyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-(2-bromo-4-propan-2-ylphenoxy)butanoyloxy]-3-methoxyphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 19206404 |
| Molecular Formula | C26H28BrNO6 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | ethyl (E)-3-[4-[4-(2-bromo-4-propan-2-ylphenoxy)butanoyloxy]-3-methoxyphenyl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(OC(=O)CCCOc2ccc(C(C)C)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C26H28BrNO6/c1-5-32-26(30)20(16-28)13-18-8-10-23(24(14-18)31-4)34-25(29)7-6-12-33-22-11-9-19(17(2)3)15-21(22)27/h8-11,13-15,17H,5-7,12H2,1-4H3/b20-13+ |
| InChIKey | AOKALHVVTKMYAF-DEDYPNTBSA-N |
| XLogP | 5.82 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|