C24H25NO7 — CID 3610975
ethyl 2-cyano-3-[3-methoxy-4-[4-(4-methoxyphenoxy)butanoyloxy]phenyl]prop-2-enoate (PubChem CID 3610975) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is ethyl 2-cyano-3-[3-methoxy-4-[4-(4-methoxyphenoxy)butanoyloxy]phenyl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[3-methoxy-4-[4-(4-methoxyphenoxy)butanoyloxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3610975 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | ethyl 2-cyano-3-[3-methoxy-4-[4-(4-methoxyphenoxy)butanoyloxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(OC(=O)CCCOc2ccc(OC)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H25NO7/c1-4-30-24(27)18(16-25)14-17-7-12-21(22(15-17)29-3)32-23(26)6-5-13-31-20-10-8-19(28-2)9-11-20/h7-12,14-15H,4-6,13H2,1-3H3 |
| InChIKey | IIRIXZKYHUDLFG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|