C30H29NO6 — CID 19179379
ethyl (E)-2-cyano-3-[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]acetyl]oxyphenyl]prop-2-enoate (PubChem CID 19179379) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]acetyl]oxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]acetyl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19179379 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-methoxy-4-[2-[4-(2-phenylpropan-2-yl)phenoxy]acetyl]oxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(OC(=O)COc2ccc(C(C)(C)c3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C30H29NO6/c1-5-35-29(33)22(19-31)17-21-11-16-26(27(18-21)34-4)37-28(32)20-36-25-14-12-24(13-15-25)30(2,3)23-9-7-6-8-10-23/h6-18H,5,20H2,1-4H3/b22-17+ |
| InChIKey | IROQUFTZCDHCOG-OQKWZONESA-N |
| XLogP | 5.48 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|