C24H23NO6 — CID 1407142
ethyl (E)-2-cyano-3-[3-methoxy-4-[2-(2-prop-2-enylphenoxy)acetyl]oxyphenyl]prop-2-enoate (PubChem CID 1407142) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-methoxy-4-[2-(2-prop-2-enylphenoxy)acetyl]oxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-methoxy-4-[2-(2-prop-2-enylphenoxy)acetyl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 1407142 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-methoxy-4-[2-(2-prop-2-enylphenoxy)acetyl]oxyphenyl]prop-2-enoate |
| SMILES | C=CCc1ccccc1OCC(=O)Oc1ccc(/C=C(\C#N)C(=O)OCC)cc1OC |
| InChI | InChI=1S/C24H23NO6/c1-4-8-18-9-6-7-10-20(18)30-16-23(26)31-21-12-11-17(14-22(21)28-3)13-19(15-25)24(27)29-5-2/h4,6-7,9-14H,1,5,8,16H2,2-3H3/b19-13+ |
| InChIKey | XZOXKCSZNPWBRZ-CPNJWEJPSA-N |
| XLogP | 3.88 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|