C20H16BrNO6 — CID 19173801
methyl (E)-3-[4-[2-(2-bromophenoxy)acetyl]oxy-3-methoxyphenyl]-2-cyanoprop-2-enoate (PubChem CID 19173801) has the molecular formula C20H16BrNO6 and a molecular weight of 446.25 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-(2-bromophenoxy)acetyl]oxy-3-methoxyphenyl]-2-cyanoprop-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-(2-bromophenoxy)acetyl]oxy-3-methoxyphenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 19173801 |
| Molecular Formula | C20H16BrNO6 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | methyl (E)-3-[4-[2-(2-bromophenoxy)acetyl]oxy-3-methoxyphenyl]-2-cyanoprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1ccc(OC(=O)COc2ccccc2Br)c(OC)c1 |
| InChI | InChI=1S/C20H16BrNO6/c1-25-18-10-13(9-14(11-22)20(24)26-2)7-8-17(18)28-19(23)12-27-16-6-4-3-5-15(16)21/h3-10H,12H2,1-2H3/b14-9+ |
| InChIKey | SDNDNLGFFWVLQT-NTEUORMPSA-N |
| XLogP | 3.52 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|